C22H39NO9Si — CID 102035214
[(2R,3S,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxyoxan-2-yl]methyl acetate (PubChem CID 102035214) has the molecular formula C22H39NO9Si and a molecular weight of 489.64 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102035214 |
| Molecular Formula | C22H39NO9Si |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C(C)C)O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C22H39NO9Si/c1-12(2)22(7,8)33(9,10)32-21-18(23-13(3)24)20(30-16(6)27)19(29-15(5)26)17(31-21)11-28-14(4)25/h12,17-21H,11H2,1-10H3,(H,23,24)/t17-,18-,19-,20-,21+/m1/s1 |
| InChIKey | YSDHDWJNHVLDJW-ONUIULTDSA-N |
| XLogP | 2.30 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|