C26H42N2O12 — CID 142653408
tert-butyl 2-[4-[2-[(2R,3S,4R,5R,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]ethoxy]butanoylamino]acetate (PubChem CID 142653408) has the molecular formula C26H42N2O12 and a molecular weight of 574.62 g/mol. Its IUPAC name is tert-butyl 2-[4-[2-[(2R,3S,4R,5R,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]ethoxy]butanoylamino]acetate.
| Compound Name | tert-butyl 2-[4-[2-[(2R,3S,4R,5R,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]ethoxy]butanoylamino]acetate |
|---|---|
| PubChem CID | 142653408 |
| Molecular Formula | C26H42N2O12 |
| Molecular Weight | 574.62 g/mol |
| Exact Mass | 574.27 |
| IUPAC Name | tert-butyl 2-[4-[2-[(2R,3S,4R,5R,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]ethoxy]butanoylamino]acetate |
| SMILES | CC(=O)N[C@@H]1[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](COC(C)=O)O[C@@H]1CCOCCCC(=O)NCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H42N2O12/c1-15(29)28-23-19(10-12-35-11-8-9-21(33)27-13-22(34)40-26(5,6)7)39-20(14-36-16(2)30)24(37-17(3)31)25(23)38-18(4)32/h19-20,23-25H,8-14H2,1-7H3,(H,27,33)(H,28,29)/t19-,20-,23+,24+,25-/m1/s1 |
| InChIKey | UGEVYIWQJUVXET-BUGIRRBRSA-N |
| XLogP | 0.33 |
| TPSA | 181.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.62 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|