C21H33N3O9 — CID 134864483
[(2R,3S,4R,5S,6S)-5-acetamido-3,4-diacetyloxy-6-(cyclohexylcarbamoylamino)oxan-2-yl]methyl acetate (PubChem CID 134864483) has the molecular formula C21H33N3O9 and a molecular weight of 471.51 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6S)-5-acetamido-3,4-diacetyloxy-6-(cyclohexylcarbamoylamino)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5S,6S)-5-acetamido-3,4-diacetyloxy-6-(cyclohexylcarbamoylamino)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134864483 |
| Molecular Formula | C21H33N3O9 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | [(2R,3S,4R,5S,6S)-5-acetamido-3,4-diacetyloxy-6-(cyclohexylcarbamoylamino)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)N[C@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O[C@@H]1NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C21H33N3O9/c1-11(25)22-17-19(32-14(4)28)18(31-13(3)27)16(10-30-12(2)26)33-20(17)24-21(29)23-15-8-6-5-7-9-15/h15-20H,5-10H2,1-4H3,(H,22,25)(H2,23,24,29)/t16-,17+,18-,19-,20+/m1/s1 |
| InChIKey | IPRUIPPSKVBABR-IVDHNXQLSA-N |
| XLogP | 0.27 |
| TPSA | 158.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|