C17H25ClN4O10 — CID 54372329
[(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[[2-chloroethyl(nitroso)carbamoyl]amino]oxan-2-yl]methyl acetate (PubChem CID 54372329) has the molecular formula C17H25ClN4O10 and a molecular weight of 480.86 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[[2-chloroethyl(nitroso)carbamoyl]amino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[[2-chloroethyl(nitroso)carbamoyl]amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 54372329 |
| Molecular Formula | C17H25ClN4O10 |
| Molecular Weight | 480.86 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[[2-chloroethyl(nitroso)carbamoyl]amino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)N[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O[C@H]1NC(=O)N(CCCl)N=O |
| InChI | InChI=1S/C17H25ClN4O10/c1-8(23)19-13-15(31-11(4)26)14(30-10(3)25)12(7-29-9(2)24)32-16(13)20-17(27)22(21-28)6-5-18/h12-16H,5-7H2,1-4H3,(H,19,23)(H,20,27)/t12-,13-,14-,15-,16-/m1/s1 |
| InChIKey | UUBOZONHWGKYRD-OXGONZEZSA-N |
| XLogP | -0.43 |
| TPSA | 179.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.86 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|