C28H39N3O11 — CID 98299230
[(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]oxan-2-yl]methyl acetate (PubChem CID 98299230) has the molecular formula C28H39N3O11 and a molecular weight of 593.63 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 98299230 |
| Molecular Formula | C28H39N3O11 |
| Molecular Weight | 593.63 g/mol |
| Exact Mass | 593.26 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)N[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O[C@H]1NC(=O)[C@@H](Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H39N3O11/c1-15(32)29-22-24(40-18(4)35)23(39-17(3)34)21(14-38-16(2)33)41-26(22)31-25(36)20(13-19-11-9-8-10-12-19)30-27(37)42-28(5,6)7/h8-12,20-24,26H,13-14H2,1-7H3,(H,29,32)(H,30,37)(H,31,36)/t20-,21-,22-,23-,24-,26-/m1/s1 |
| InChIKey | ACILTWCSLLAQIA-KZSUKHDLSA-N |
| XLogP | 0.89 |
| TPSA | 184.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.63 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|