C30H42N4O11S — CID 122387407
[(2R,3S,4R,5R,6S)-5-acetamido-6-[(2S)-3-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-2-methyl-1-(methylamino)-1-oxopropan-2-yl]sulfanyl-3,4-diacetyloxyoxan-2-yl]methyl acetate (PubChem CID 122387407) has the molecular formula C30H42N4O11S and a molecular weight of 666.75 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-5-acetamido-6-[(2S)-3-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-2-methyl-1-(methylamino)-1-oxopropan-2-yl]sulfanyl-3,4-diacetyloxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-5-acetamido-6-[(2S)-3-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-2-methyl-1-(methylamino)-1-oxopropan-2-yl]sulfanyl-3,4-diacetyloxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 122387407 |
| Molecular Formula | C30H42N4O11S |
| Molecular Weight | 666.75 g/mol |
| Exact Mass | 666.26 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-5-acetamido-6-[(2S)-3-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-2-methyl-1-(methylamino)-1-oxopropan-2-yl]sulfanyl-3,4-diacetyloxyoxan-2-yl]methyl acetate |
| SMILES | CNC(=O)[C@](C)(CNC(=O)[C@H](Cc1ccccc1)NC(C)=O)S[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C30H42N4O11S/c1-16(35)33-22(13-21-11-9-8-10-12-21)27(40)32-15-30(6,29(41)31-7)46-28-24(34-17(2)36)26(44-20(5)39)25(43-19(4)38)23(45-28)14-42-18(3)37/h8-12,22-26,28H,13-15H2,1-7H3,(H,31,41)(H,32,40)(H,33,35)(H,34,36)/t22-,23+,24+,25+,26+,28-,30-/m0/s1 |
| InChIKey | DFQAJDZTFYDTJR-UBHUPHQKSA-N |
| XLogP | -0.26 |
| TPSA | 204.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.75 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|