C24H30N4O8S — CID 98450438
[(2S,3S,4S,5S,6R)-5-acetamido-3,4-diacetyloxy-6-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]oxan-2-yl]methyl acetate (PubChem CID 98450438) has the molecular formula C24H30N4O8S and a molecular weight of 534.59 g/mol. Its IUPAC name is [(2S,3S,4S,5S,6R)-5-acetamido-3,4-diacetyloxy-6-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4S,5S,6R)-5-acetamido-3,4-diacetyloxy-6-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 98450438 |
| Molecular Formula | C24H30N4O8S |
| Molecular Weight | 534.59 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | [(2S,3S,4S,5S,6R)-5-acetamido-3,4-diacetyloxy-6-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]oxan-2-yl]methyl acetate |
| SMILES | CCn1c(S[C@H]2O[C@@H](COC(C)=O)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]2NC(C)=O)nnc1-c1ccccc1 |
| InChI | InChI=1S/C24H30N4O8S/c1-6-28-22(17-10-8-7-9-11-17)26-27-24(28)37-23-19(25-13(2)29)21(35-16(5)32)20(34-15(4)31)18(36-23)12-33-14(3)30/h7-11,18-21,23H,6,12H2,1-5H3,(H,25,29)/t18-,19-,20+,21-,23+/m0/s1 |
| InChIKey | KTNMCEHJGUQNFK-KHYDEXNFSA-N |
| XLogP | 1.71 |
| TPSA | 147.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.59 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|