C29H40N4O9S — CID 98407050
[(2S,3S,4S,5R,6S)-5-acetamido-3,4-diacetyloxy-6-[[5-[(4-methylphenoxy)methyl]-4-pentyl-1,2,4-triazol-3-yl]sulfanyl]oxan-2-yl]methyl acetate (PubChem CID 98407050) has the molecular formula C29H40N4O9S and a molecular weight of 620.73 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6S)-5-acetamido-3,4-diacetyloxy-6-[[5-[(4-methylphenoxy)methyl]-4-pentyl-1,2,4-triazol-3-yl]sulfanyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4S,5R,6S)-5-acetamido-3,4-diacetyloxy-6-[[5-[(4-methylphenoxy)methyl]-4-pentyl-1,2,4-triazol-3-yl]sulfanyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 98407050 |
| Molecular Formula | C29H40N4O9S |
| Molecular Weight | 620.73 g/mol |
| Exact Mass | 620.25 |
| IUPAC Name | [(2S,3S,4S,5R,6S)-5-acetamido-3,4-diacetyloxy-6-[[5-[(4-methylphenoxy)methyl]-4-pentyl-1,2,4-triazol-3-yl]sulfanyl]oxan-2-yl]methyl acetate |
| SMILES | CCCCCn1c(COc2ccc(C)cc2)nnc1S[C@@H]1O[C@@H](COC(C)=O)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C29H40N4O9S/c1-7-8-9-14-33-24(16-39-22-12-10-17(2)11-13-22)31-32-29(33)43-28-25(30-18(3)34)27(41-21(6)37)26(40-20(5)36)23(42-28)15-38-19(4)35/h10-13,23,25-28H,7-9,14-16H2,1-6H3,(H,30,34)/t23-,25+,26+,27-,28-/m0/s1 |
| InChIKey | IDHMNZSPRJRTPO-PLPYLBSESA-N |
| XLogP | 3.10 |
| TPSA | 157.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.73 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|