C23H27ClN4O8S — CID 125354076
[(2R,3S,4R,5S,6S)-5-acetamido-3,4-diacetyloxy-6-[[5-(2-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]oxan-2-yl]methyl acetate (PubChem CID 125354076) has the molecular formula C23H27ClN4O8S and a molecular weight of 555.01 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6S)-5-acetamido-3,4-diacetyloxy-6-[[5-(2-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5S,6S)-5-acetamido-3,4-diacetyloxy-6-[[5-(2-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 125354076 |
| Molecular Formula | C23H27ClN4O8S |
| Molecular Weight | 555.01 g/mol |
| Exact Mass | 554.12 |
| IUPAC Name | [(2R,3S,4R,5S,6S)-5-acetamido-3,4-diacetyloxy-6-[[5-(2-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)N[C@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O[C@H]1Sc1nnc(-c2ccccc2Cl)n1C |
| InChI | InChI=1S/C23H27ClN4O8S/c1-11(29)25-18-20(35-14(4)32)19(34-13(3)31)17(10-33-12(2)30)36-22(18)37-23-27-26-21(28(23)5)15-8-6-7-9-16(15)24/h6-9,17-20,22H,10H2,1-5H3,(H,25,29)/t17-,18+,19-,20-,22+/m1/s1 |
| InChIKey | UIBDVSGDFNBCJN-BEZXDORVSA-N |
| XLogP | 1.88 |
| TPSA | 147.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.01 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|