C29H42N2O10S2 — CID 24740869
[(2R,3S,4R,5R,6R)-3,4-diacetyloxy-6-cyclohexylsulfanyl-5-[[(2S)-2-(methanesulfonamido)-4-phenylbutanoyl]amino]oxan-2-yl]methyl acetate (PubChem CID 24740869) has the molecular formula C29H42N2O10S2 and a molecular weight of 642.79 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-6-cyclohexylsulfanyl-5-[[(2S)-2-(methanesulfonamido)-4-phenylbutanoyl]amino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-6-cyclohexylsulfanyl-5-[[(2S)-2-(methanesulfonamido)-4-phenylbutanoyl]amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 24740869 |
| Molecular Formula | C29H42N2O10S2 |
| Molecular Weight | 642.79 g/mol |
| Exact Mass | 642.23 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-6-cyclohexylsulfanyl-5-[[(2S)-2-(methanesulfonamido)-4-phenylbutanoyl]amino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](SC2CCCCC2)[C@H](NC(=O)[C@H](CCc2ccccc2)NS(C)(=O)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C29H42N2O10S2/c1-18(32)38-17-24-26(39-19(2)33)27(40-20(3)34)25(29(41-24)42-22-13-9-6-10-14-22)30-28(35)23(31-43(4,36)37)16-15-21-11-7-5-8-12-21/h5,7-8,11-12,22-27,29,31H,6,9-10,13-17H2,1-4H3,(H,30,35)/t23-,24+,25+,26+,27+,29+/m0/s1 |
| InChIKey | NYHCDIPDEOSVKM-VUKPHJNGSA-N |
| XLogP | 2.24 |
| TPSA | 163.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.79 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|