C20H24Cl3NO8S — CID 40746907
[(2R,3S,4R,5R,6S)-3,4-diacetyloxy-6-phenylsulfanyl-5-[[(1S)-2,2,2-trichloro-1-hydroxyethyl]amino]oxan-2-yl]methyl acetate (PubChem CID 40746907) has the molecular formula C20H24Cl3NO8S and a molecular weight of 544.84 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-3,4-diacetyloxy-6-phenylsulfanyl-5-[[(1S)-2,2,2-trichloro-1-hydroxyethyl]amino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-3,4-diacetyloxy-6-phenylsulfanyl-5-[[(1S)-2,2,2-trichloro-1-hydroxyethyl]amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 40746907 |
| Molecular Formula | C20H24Cl3NO8S |
| Molecular Weight | 544.84 g/mol |
| Exact Mass | 543.03 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-3,4-diacetyloxy-6-phenylsulfanyl-5-[[(1S)-2,2,2-trichloro-1-hydroxyethyl]amino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Sc2ccccc2)[C@H](N[C@@H](O)C(Cl)(Cl)Cl)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H24Cl3NO8S/c1-10(25)29-9-14-16(30-11(2)26)17(31-12(3)27)15(24-19(28)20(21,22)23)18(32-14)33-13-7-5-4-6-8-13/h4-8,14-19,24,28H,9H2,1-3H3/t14-,15-,16-,17-,18+,19+/m1/s1 |
| InChIKey | KOGJCNZKPPVDLZ-QMROVXIMSA-N |
| XLogP | 2.58 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.84 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|