C28H34NO11PS — CID 102159262
[(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-bis(phenylmethoxy)phosphorylsulfanyloxan-2-yl]methyl acetate (PubChem CID 102159262) has the molecular formula C28H34NO11PS and a molecular weight of 623.62 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-bis(phenylmethoxy)phosphorylsulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-bis(phenylmethoxy)phosphorylsulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102159262 |
| Molecular Formula | C28H34NO11PS |
| Molecular Weight | 623.62 g/mol |
| Exact Mass | 623.16 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-bis(phenylmethoxy)phosphorylsulfanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)N[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O[C@@H]1SP(=O)(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C28H34NO11PS/c1-18(30)29-25-27(39-21(4)33)26(38-20(3)32)24(17-35-19(2)31)40-28(25)42-41(34,36-15-22-11-7-5-8-12-22)37-16-23-13-9-6-10-14-23/h5-14,24-28H,15-17H2,1-4H3,(H,29,30)/t24-,25-,26-,27-,28-/m1/s1 |
| InChIKey | KEIDBZAFKKTGSR-JQPIIJRMSA-N |
| XLogP | 3.92 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.62 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|