C27H35NO10 — CID 166015472
benzyl (Z)-6-[(2R,4R,5R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]hex-4-enoate (PubChem CID 166015472) has the molecular formula C27H35NO10 and a molecular weight of 533.57 g/mol. Its IUPAC name is benzyl (Z)-6-[(2R,4R,5R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]hex-4-enoate.
| Compound Name | benzyl (Z)-6-[(2R,4R,5R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]hex-4-enoate |
|---|---|
| PubChem CID | 166015472 |
| Molecular Formula | C27H35NO10 |
| Molecular Weight | 533.57 g/mol |
| Exact Mass | 533.23 |
| IUPAC Name | benzyl (Z)-6-[(2R,4R,5R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]hex-4-enoate |
| SMILES | CC(=O)NC1[C@@H](OC(C)=O)[C@@H](OC(C)=O)C(COC(C)=O)O[C@@H]1C/C=C\CCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H35NO10/c1-17(29)28-25-22(13-9-6-10-14-24(33)35-15-21-11-7-5-8-12-21)38-23(16-34-18(2)30)26(36-19(3)31)27(25)37-20(4)32/h5-9,11-12,22-23,25-27H,10,13-16H2,1-4H3,(H,28,29)/b9-6-/t22-,23?,25?,26+,27-/m1/s1 |
| InChIKey | NGPSMENWHHMZQC-XFBOOQGPSA-N |
| XLogP | 2.15 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.57 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|