C27H34O5 — CID 134931096
[(2R,3R,4S)-5-[(E)-hex-2-enyl]-3,4-bis(phenylmethoxy)oxolan-2-yl]methyl acetate (PubChem CID 134931096) has the molecular formula C27H34O5 and a molecular weight of 438.56 g/mol. Its IUPAC name is [(2R,3R,4S)-5-[(E)-hex-2-enyl]-3,4-bis(phenylmethoxy)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S)-5-[(E)-hex-2-enyl]-3,4-bis(phenylmethoxy)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134931096 |
| Molecular Formula | C27H34O5 |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | [(2R,3R,4S)-5-[(E)-hex-2-enyl]-3,4-bis(phenylmethoxy)oxolan-2-yl]methyl acetate |
| SMILES | CCC/C=C/CC1O[C@H](COC(C)=O)[C@@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C27H34O5/c1-3-4-5-12-17-24-26(30-18-22-13-8-6-9-14-22)27(25(32-24)20-29-21(2)28)31-19-23-15-10-7-11-16-23/h5-16,24-27H,3-4,17-20H2,1-2H3/b12-5+/t24?,25-,26+,27-/m1/s1 |
| InChIKey | DXZPPZRMRAVHJR-ZUNOEALMSA-N |
| XLogP | 5.23 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|