C32H37N3O11 — CID 24741128
[(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino]oxan-2-yl]methyl acetate (PubChem CID 24741128) has the molecular formula C32H37N3O11 and a molecular weight of 639.66 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 24741128 |
| Molecular Formula | C32H37N3O11 |
| Molecular Weight | 639.66 g/mol |
| Exact Mass | 639.24 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]amino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)N[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O[C@H]1NC(=O)[C@H](C)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C32H37N3O11/c1-16(33-32(41)43-14-25-23-12-8-6-10-21(23)22-11-7-9-13-24(22)25)30(40)35-31-27(34-17(2)36)29(45-20(5)39)28(44-19(4)38)26(46-31)15-42-18(3)37/h6-13,16,25-29,31H,14-15H2,1-5H3,(H,33,41)(H,34,36)(H,35,40)/t16-,26+,27+,28+,29+,31+/m0/s1 |
| InChIKey | NZWAJDVIVODPCM-OQVUYGHASA-N |
| XLogP | 1.69 |
| TPSA | 184.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.66 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|