C34H39N3O13 — CID 124841664
[(2S,3S,4R,5R,6S)-4-acetamido-3,5-diacetyloxy-6-[[(Z,3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4,5-dihydroxypent-4-enoyl]amino]oxan-2-yl]methyl acetate (PubChem CID 124841664) has the molecular formula C34H39N3O13 and a molecular weight of 697.69 g/mol. Its IUPAC name is [(2S,3S,4R,5R,6S)-4-acetamido-3,5-diacetyloxy-6-[[(Z,3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4,5-dihydroxypent-4-enoyl]amino]oxan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4R,5R,6S)-4-acetamido-3,5-diacetyloxy-6-[[(Z,3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4,5-dihydroxypent-4-enoyl]amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 124841664 |
| Molecular Formula | C34H39N3O13 |
| Molecular Weight | 697.69 g/mol |
| Exact Mass | 697.25 |
| IUPAC Name | [(2S,3S,4R,5R,6S)-4-acetamido-3,5-diacetyloxy-6-[[(Z,3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4,5-dihydroxypent-4-enoyl]amino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)N[C@H]1[C@@H](OC(C)=O)[C@@H](NC(=O)C[C@H](NC(=O)OCC2c3ccccc3-c3ccccc32)/C(O)=C/O)O[C@@H](COC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C34H39N3O13/c1-17(39)35-30-31(48-19(3)41)28(16-46-18(2)40)50-33(32(30)49-20(4)42)37-29(44)13-26(27(43)14-38)36-34(45)47-15-25-23-11-7-5-9-21(23)22-10-6-8-12-24(22)25/h5-12,14,25-26,28,30-33,38,43H,13,15-16H2,1-4H3,(H,35,39)(H,36,45)(H,37,44)/b27-14-/t26-,28-,30+,31+,32+,33-/m0/s1 |
| InChIKey | AWUHWCGAUJTMSZ-YAVSDLSYSA-N |
| XLogP | 2.01 |
| TPSA | 225.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.69 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|