C43H60N2O12 — CID 24772919
[(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]oxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 24772919) has the molecular formula C43H60N2O12 and a molecular weight of 796.96 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]oxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]oxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 24772919 |
| Molecular Formula | C43H60N2O12 |
| Molecular Weight | 796.96 g/mol |
| Exact Mass | 796.41 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]oxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@H]1O[C@@H](NC(=O)[C@H](Cc2ccccc2)NC(=O)OCc2ccccc2)[C@H](OC(=O)C(C)(C)C)[C@@H](OC(=O)C(C)(C)C)[C@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C43H60N2O12/c1-40(2,3)35(47)52-25-29-30(55-36(48)41(4,5)6)31(56-37(49)42(7,8)9)32(57-38(50)43(10,11)12)34(54-29)45-33(46)28(23-26-19-15-13-16-20-26)44-39(51)53-24-27-21-17-14-18-22-27/h13-22,28-32,34H,23-25H2,1-12H3,(H,44,51)(H,45,46)/t28-,29+,30-,31-,32+,34+/m0/s1 |
| InChIKey | OIHXJUFVFNWZGX-BPDJRJGFSA-N |
| XLogP | 5.83 |
| TPSA | 181.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.96 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|