C24H33N5O11 — CID 177482734
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[(2S)-2-cyano-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]triazol-1-yl]oxan-2-yl]methyl acetate (PubChem CID 177482734) has the molecular formula C24H33N5O11 and a molecular weight of 567.55 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[(2S)-2-cyano-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]triazol-1-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[(2S)-2-cyano-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]triazol-1-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 177482734 |
| Molecular Formula | C24H33N5O11 |
| Molecular Weight | 567.55 g/mol |
| Exact Mass | 567.22 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[(2S)-2-cyano-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]triazol-1-yl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cc(C[C@@H](C#N)NC(=O)OC(C)(C)C)nn2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H33N5O11/c1-12(30)35-11-18-19(36-13(2)31)20(37-14(3)32)21(38-15(4)33)22(39-18)29-10-17(27-28-29)8-16(9-25)26-23(34)40-24(5,6)7/h10,16,18-22H,8,11H2,1-7H3,(H,26,34)/t16-,18+,19+,20-,21+,22+/m0/s1 |
| InChIKey | HQQSCBOWVLZDGN-MVDZHRGESA-N |
| XLogP | 0.49 |
| TPSA | 207.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.55 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|