C21H29NO11 — CID 24897131
tert-butyl (2S)-2-cyano-2-[(2S,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]acetate (PubChem CID 24897131) has the molecular formula C21H29NO11 and a molecular weight of 471.46 g/mol. Its IUPAC name is tert-butyl (2S)-2-cyano-2-[(2S,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]acetate.
| Compound Name | tert-butyl (2S)-2-cyano-2-[(2S,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]acetate |
|---|---|
| PubChem CID | 24897131 |
| Molecular Formula | C21H29NO11 |
| Molecular Weight | 471.46 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | tert-butyl (2S)-2-cyano-2-[(2S,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H]([C@H](C#N)C(=O)OC(C)(C)C)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H29NO11/c1-10(23)28-9-15-17(29-11(2)24)19(31-13(4)26)18(30-12(3)25)16(32-15)14(8-22)20(27)33-21(5,6)7/h14-19H,9H2,1-7H3/t14-,15+,16-,17+,18-,19-/m0/s1 |
| InChIKey | NMJJHMSRPJBHJY-WXJALIKYSA-N |
| XLogP | 0.59 |
| TPSA | 164.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.46 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|