C37H45N7O20 — CID 102222043
ethyl 2-cyano-2,2-bis[1-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]triazol-4-yl]acetate (PubChem CID 102222043) has the molecular formula C37H45N7O20 and a molecular weight of 907.80 g/mol. Its IUPAC name is ethyl 2-cyano-2,2-bis[1-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]triazol-4-yl]acetate.
| Compound Name | ethyl 2-cyano-2,2-bis[1-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]triazol-4-yl]acetate |
|---|---|
| PubChem CID | 102222043 |
| Molecular Formula | C37H45N7O20 |
| Molecular Weight | 907.80 g/mol |
| Exact Mass | 907.27 |
| IUPAC Name | ethyl 2-cyano-2,2-bis[1-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]triazol-4-yl]acetate |
| SMILES | CCOC(=O)C(C#N)(c1cn([C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)nn1)c1cn([C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)nn1 |
| InChI | InChI=1S/C37H45N7O20/c1-10-54-36(53)37(15-38,26-11-43(41-39-26)34-32(61-22(8)51)30(59-20(6)49)28(57-18(4)47)24(63-34)13-55-16(2)45)27-12-44(42-40-27)35-33(62-23(9)52)31(60-21(7)50)29(58-19(5)48)25(64-35)14-56-17(3)46/h11-12,24-25,28-35H,10,13-14H2,1-9H3/t24-,25-,28-,29-,30+,31+,32-,33-,34-,35-/m1/s1 |
| InChIKey | RKVLXFCWZURRRH-PCFYVWCQSA-N |
| XLogP | -1.25 |
| TPSA | 340.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 27 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 907.80 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 27 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|