C25H31N5O10 — CID 44817201
[3,4,5-triacetyloxy-6-[5-[2-oxo-2-(1-phenylethylamino)ethyl]tetrazol-2-yl]oxan-2-yl]methyl acetate (PubChem CID 44817201) has the molecular formula C25H31N5O10 and a molecular weight of 561.55 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-[5-[2-oxo-2-(1-phenylethylamino)ethyl]tetrazol-2-yl]oxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-[5-[2-oxo-2-(1-phenylethylamino)ethyl]tetrazol-2-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 44817201 |
| Molecular Formula | C25H31N5O10 |
| Molecular Weight | 561.55 g/mol |
| Exact Mass | 561.21 |
| IUPAC Name | [3,4,5-triacetyloxy-6-[5-[2-oxo-2-(1-phenylethylamino)ethyl]tetrazol-2-yl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(n2nnc(CC(=O)NC(C)c3ccccc3)n2)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C25H31N5O10/c1-13(18-9-7-6-8-10-18)26-21(35)11-20-27-29-30(28-20)25-24(39-17(5)34)23(38-16(4)33)22(37-15(3)32)19(40-25)12-36-14(2)31/h6-10,13,19,22-25H,11-12H2,1-5H3,(H,26,35) |
| InChIKey | RKWWVQGUSAVWSV-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 187.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.55 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|