C20H25N5O5 — CID 91523344
[2-[5-[2-[1-(4-methoxyphenyl)ethylamino]-2-oxoethyl]tetrazol-2-yl]-3,6-dihydro-2H-pyran-6-yl]methyl acetate (PubChem CID 91523344) has the molecular formula C20H25N5O5 and a molecular weight of 415.45 g/mol. Its IUPAC name is [2-[5-[2-[1-(4-methoxyphenyl)ethylamino]-2-oxoethyl]tetrazol-2-yl]-3,6-dihydro-2H-pyran-6-yl]methyl acetate.
| Compound Name | [2-[5-[2-[1-(4-methoxyphenyl)ethylamino]-2-oxoethyl]tetrazol-2-yl]-3,6-dihydro-2H-pyran-6-yl]methyl acetate |
|---|---|
| PubChem CID | 91523344 |
| Molecular Formula | C20H25N5O5 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | [2-[5-[2-[1-(4-methoxyphenyl)ethylamino]-2-oxoethyl]tetrazol-2-yl]-3,6-dihydro-2H-pyran-6-yl]methyl acetate |
| SMILES | COc1ccc(C(C)NC(=O)Cc2nnn(C3CC=CC(COC(C)=O)O3)n2)cc1 |
| InChI | InChI=1S/C20H25N5O5/c1-13(15-7-9-16(28-3)10-8-15)21-19(27)11-18-22-24-25(23-18)20-6-4-5-17(30-20)12-29-14(2)26/h4-5,7-10,13,17,20H,6,11-12H2,1-3H3,(H,21,27) |
| InChIKey | POFJIUMQKCLXLW-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 117.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|