C25H29NO5 — CID 90937450
[2-[4-[1-[(4-ethylbenzoyl)amino]ethyl]phenoxy]-3,6-dihydro-2H-pyran-6-yl]methyl acetate (PubChem CID 90937450) has the molecular formula C25H29NO5 and a molecular weight of 423.51 g/mol. Its IUPAC name is [2-[4-[1-[(4-ethylbenzoyl)amino]ethyl]phenoxy]-3,6-dihydro-2H-pyran-6-yl]methyl acetate.
| Compound Name | [2-[4-[1-[(4-ethylbenzoyl)amino]ethyl]phenoxy]-3,6-dihydro-2H-pyran-6-yl]methyl acetate |
|---|---|
| PubChem CID | 90937450 |
| Molecular Formula | C25H29NO5 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | [2-[4-[1-[(4-ethylbenzoyl)amino]ethyl]phenoxy]-3,6-dihydro-2H-pyran-6-yl]methyl acetate |
| SMILES | CCc1ccc(C(=O)NC(C)c2ccc(OC3CC=CC(COC(C)=O)O3)cc2)cc1 |
| InChI | InChI=1S/C25H29NO5/c1-4-19-8-10-21(11-9-19)25(28)26-17(2)20-12-14-22(15-13-20)30-24-7-5-6-23(31-24)16-29-18(3)27/h5-6,8-15,17,23-24H,4,7,16H2,1-3H3,(H,26,28) |
| InChIKey | IECAEJBXRFVYKB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|