C29H32FNO11 — CID 70919969
[3,4,5-triacetyloxy-6-[4-[1-[(4-fluorobenzoyl)amino]ethyl]phenoxy]oxan-2-yl]methyl acetate (PubChem CID 70919969) has the molecular formula C29H32FNO11 and a molecular weight of 589.57 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-[4-[1-[(4-fluorobenzoyl)amino]ethyl]phenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-[4-[1-[(4-fluorobenzoyl)amino]ethyl]phenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 70919969 |
| Molecular Formula | C29H32FNO11 |
| Molecular Weight | 589.57 g/mol |
| Exact Mass | 589.20 |
| IUPAC Name | [3,4,5-triacetyloxy-6-[4-[1-[(4-fluorobenzoyl)amino]ethyl]phenoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(Oc2ccc(C(C)NC(=O)c3ccc(F)cc3)cc2)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C29H32FNO11/c1-15(31-28(36)21-6-10-22(30)11-7-21)20-8-12-23(13-9-20)41-29-27(40-19(5)35)26(39-18(4)34)25(38-17(3)33)24(42-29)14-37-16(2)32/h6-13,15,24-27,29H,14H2,1-5H3,(H,31,36) |
| InChIKey | ZJLRLFDAQSLWBE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.57 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|