C30H35NO10 — CID 70919921
[3,4,5-triacetyloxy-6-[[4-[[(1R)-1-phenylethyl]carbamoyl]phenyl]methyl]oxan-2-yl]methyl acetate (PubChem CID 70919921) has the molecular formula C30H35NO10 and a molecular weight of 569.61 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-[[4-[[(1R)-1-phenylethyl]carbamoyl]phenyl]methyl]oxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-[[4-[[(1R)-1-phenylethyl]carbamoyl]phenyl]methyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 70919921 |
| Molecular Formula | C30H35NO10 |
| Molecular Weight | 569.61 g/mol |
| Exact Mass | 569.23 |
| IUPAC Name | [3,4,5-triacetyloxy-6-[[4-[[(1R)-1-phenylethyl]carbamoyl]phenyl]methyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(Cc2ccc(C(=O)N[C@H](C)c3ccccc3)cc2)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C30H35NO10/c1-17(23-9-7-6-8-10-23)31-30(36)24-13-11-22(12-14-24)15-25-27(38-19(3)33)29(40-21(5)35)28(39-20(4)34)26(41-25)16-37-18(2)32/h6-14,17,25-29H,15-16H2,1-5H3,(H,31,36)/t17-,25?,26?,27?,28?,29?/m1/s1 |
| InChIKey | OSUURCSPDGMSIC-NXRBVWBFSA-N |
| XLogP | 2.85 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.61 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|