C26H33NO13 — CID 102008751
methyl 2-(phenylmethoxycarbonylamino)-3-[(2R,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]propanoate (PubChem CID 102008751) has the molecular formula C26H33NO13 and a molecular weight of 567.54 g/mol. Its IUPAC name is methyl 2-(phenylmethoxycarbonylamino)-3-[(2R,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]propanoate.
| Compound Name | methyl 2-(phenylmethoxycarbonylamino)-3-[(2R,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]propanoate |
|---|---|
| PubChem CID | 102008751 |
| Molecular Formula | C26H33NO13 |
| Molecular Weight | 567.54 g/mol |
| Exact Mass | 567.20 |
| IUPAC Name | methyl 2-(phenylmethoxycarbonylamino)-3-[(2R,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]propanoate |
| SMILES | COC(=O)C(C[C@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H33NO13/c1-14(28)35-13-21-23(38-16(3)30)24(39-17(4)31)22(37-15(2)29)20(40-21)11-19(25(32)34-5)27-26(33)36-12-18-9-7-6-8-10-18/h6-10,19-24H,11-13H2,1-5H3,(H,27,33)/t19?,20-,21-,22+,23-,24-/m1/s1 |
| InChIKey | PNKYCTPKGWVAMU-PDYRQOBPSA-N |
| XLogP | 0.97 |
| TPSA | 179.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.54 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|