C33H42N2O12 — CID 10532359
methyl 7-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-methoxyoxolan-2-yl]-2,5-bis(phenylmethoxycarbonylamino)heptanoate (PubChem CID 10532359) has the molecular formula C33H42N2O12 and a molecular weight of 658.70 g/mol. Its IUPAC name is methyl 7-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-methoxyoxolan-2-yl]-2,5-bis(phenylmethoxycarbonylamino)heptanoate.
| Compound Name | methyl 7-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-methoxyoxolan-2-yl]-2,5-bis(phenylmethoxycarbonylamino)heptanoate |
|---|---|
| PubChem CID | 10532359 |
| Molecular Formula | C33H42N2O12 |
| Molecular Weight | 658.70 g/mol |
| Exact Mass | 658.27 |
| IUPAC Name | methyl 7-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-methoxyoxolan-2-yl]-2,5-bis(phenylmethoxycarbonylamino)heptanoate |
| SMILES | COC(=O)C(CCC(CC[C@H]1O[C@@H](OC)[C@H](OC(C)=O)[C@@H]1OC(C)=O)NC(=O)OCc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C33H42N2O12/c1-21(36)45-28-27(47-31(42-4)29(28)46-22(2)37)18-16-25(34-32(39)43-19-23-11-7-5-8-12-23)15-17-26(30(38)41-3)35-33(40)44-20-24-13-9-6-10-14-24/h5-14,25-29,31H,15-20H2,1-4H3,(H,34,39)(H,35,40)/t25?,26?,27-,28-,29-,31-/m1/s1 |
| InChIKey | VOSZEVJFKXRUKP-DKDPUVGGSA-N |
| XLogP | 3.54 |
| TPSA | 174.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.70 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|