C25H36N2O9 — CID 10673229
methyl (2S,5S)-7-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-5-carbamoyl-2-(phenylmethoxycarbonylamino)heptanoate (PubChem CID 10673229) has the molecular formula C25H36N2O9 and a molecular weight of 508.57 g/mol. Its IUPAC name is methyl (2S,5S)-7-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-5-carbamoyl-2-(phenylmethoxycarbonylamino)heptanoate.
| Compound Name | methyl (2S,5S)-7-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-5-carbamoyl-2-(phenylmethoxycarbonylamino)heptanoate |
|---|---|
| PubChem CID | 10673229 |
| Molecular Formula | C25H36N2O9 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | methyl (2S,5S)-7-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-5-carbamoyl-2-(phenylmethoxycarbonylamino)heptanoate |
| SMILES | COC(=O)[C@H](CC[C@@H](CC[C@H]1O[C@@H](OC)[C@@H]2OC(C)(C)O[C@@H]21)C(N)=O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H36N2O9/c1-25(2)35-19-18(34-23(32-4)20(19)36-25)13-11-16(21(26)28)10-12-17(22(29)31-3)27-24(30)33-14-15-8-6-5-7-9-15/h5-9,16-20,23H,10-14H2,1-4H3,(H2,26,28)(H,27,30)/t16-,17-,18+,19+,20+,23+/m0/s1 |
| InChIKey | RHXLADZAKPYPMS-HNPOOPQVSA-N |
| XLogP | 2.01 |
| TPSA | 144.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |