C29H35NO8S — CID 69328675
methyl 4-[[(3aR,4R,6S,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylsulfanyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoate (PubChem CID 69328675) has the molecular formula C29H35NO8S and a molecular weight of 557.67 g/mol. Its IUPAC name is methyl 4-[[(3aR,4R,6S,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylsulfanyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoate.
| Compound Name | methyl 4-[[(3aR,4R,6S,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylsulfanyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 69328675 |
| Molecular Formula | C29H35NO8S |
| Molecular Weight | 557.67 g/mol |
| Exact Mass | 557.21 |
| IUPAC Name | methyl 4-[[(3aR,4R,6S,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylsulfanyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoate |
| SMILES | COC(=O)C(CCSC[C@H]1O[C@@H](OC)[C@@H]2OC(C)(C)O[C@@H]21)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C29H35NO8S/c1-29(2)37-24-23(36-27(34-4)25(24)38-29)16-39-14-13-22(26(31)33-3)30-28(32)35-15-21-19-11-7-5-9-17(19)18-10-6-8-12-20(18)21/h5-12,21-25,27H,13-16H2,1-4H3,(H,30,32)/t22?,23-,24-,25-,27-/m1/s1 |
| InChIKey | LLKSBZSKSHXEIY-YTMKARSQSA-N |
| XLogP | 4.08 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.67 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|