C31H35NO11S — CID 69403118
methyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[[(2S,3S,4R)-3,4,5-triacetyloxyoxolan-2-yl]methylsulfanyl]butanoate (PubChem CID 69403118) has the molecular formula C31H35NO11S and a molecular weight of 629.68 g/mol. Its IUPAC name is methyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[[(2S,3S,4R)-3,4,5-triacetyloxyoxolan-2-yl]methylsulfanyl]butanoate.
| Compound Name | methyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[[(2S,3S,4R)-3,4,5-triacetyloxyoxolan-2-yl]methylsulfanyl]butanoate |
|---|---|
| PubChem CID | 69403118 |
| Molecular Formula | C31H35NO11S |
| Molecular Weight | 629.68 g/mol |
| Exact Mass | 629.19 |
| IUPAC Name | methyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[[(2S,3S,4R)-3,4,5-triacetyloxyoxolan-2-yl]methylsulfanyl]butanoate |
| SMILES | COC(=O)C(CCSC[C@H]1OC(OC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C31H35NO11S/c1-17(33)40-27-26(43-30(42-19(3)35)28(27)41-18(2)34)16-44-14-13-25(29(36)38-4)32-31(37)39-15-24-22-11-7-5-9-20(22)21-10-6-8-12-23(21)24/h5-12,24-28,30H,13-16H2,1-4H3,(H,32,37)/t25?,26-,27-,28-,30?/m1/s1 |
| InChIKey | GBJRQABGRMAOBL-NIHBNWPVSA-N |
| XLogP | 3.34 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.68 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|