C38H47NO13S — CID 102416471
tert-butyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanylpentanoate (PubChem CID 102416471) has the molecular formula C38H47NO13S and a molecular weight of 757.86 g/mol. Its IUPAC name is tert-butyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanylpentanoate.
| Compound Name | tert-butyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanylpentanoate |
|---|---|
| PubChem CID | 102416471 |
| Molecular Formula | C38H47NO13S |
| Molecular Weight | 757.86 g/mol |
| Exact Mass | 757.28 |
| IUPAC Name | tert-butyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanylpentanoate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](SCCC[C@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)OC(C)(C)C)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C38H47NO13S/c1-21(40)46-20-31-32(48-22(2)41)33(49-23(3)42)34(50-24(4)43)36(51-31)53-18-12-17-30(35(44)52-38(5,6)7)39-37(45)47-19-29-27-15-10-8-13-25(27)26-14-9-11-16-28(26)29/h8-11,13-16,29-34,36H,12,17-20H2,1-7H3,(H,39,45)/t30-,31+,32+,33-,34+,36-/m0/s1 |
| InChIKey | RHBSLCYSCYIMND-KBEGACGUSA-N |
| XLogP | 4.83 |
| TPSA | 179.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.86 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|