C34H34ClN5O9S — CID 59738129
methyl 4-[[(3S,5R)-3,4-diacetyloxy-5-(6-chloropurin-9-yl)oxolan-2-yl]methylsulfanyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoate (PubChem CID 59738129) has the molecular formula C34H34ClN5O9S and a molecular weight of 724.19 g/mol. Its IUPAC name is methyl 4-[[(3S,5R)-3,4-diacetyloxy-5-(6-chloropurin-9-yl)oxolan-2-yl]methylsulfanyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoate.
| Compound Name | methyl 4-[[(3S,5R)-3,4-diacetyloxy-5-(6-chloropurin-9-yl)oxolan-2-yl]methylsulfanyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 59738129 |
| Molecular Formula | C34H34ClN5O9S |
| Molecular Weight | 724.19 g/mol |
| Exact Mass | 723.18 |
| IUPAC Name | methyl 4-[[(3S,5R)-3,4-diacetyloxy-5-(6-chloropurin-9-yl)oxolan-2-yl]methylsulfanyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoate |
| SMILES | COC(=O)C(CCSCC1O[C@@H](n2cnc3c(Cl)ncnc32)C(OC(C)=O)[C@@H]1OC(C)=O)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C34H34ClN5O9S/c1-18(41)47-28-26(49-32(29(28)48-19(2)42)40-17-38-27-30(35)36-16-37-31(27)40)15-50-13-12-25(33(43)45-3)39-34(44)46-14-24-22-10-6-4-8-20(22)21-9-5-7-11-23(21)24/h4-11,16-17,24-26,28-29,32H,12-15H2,1-3H3,(H,39,44)/t25?,26?,28-,29?,32-/m1/s1 |
| InChIKey | HTJYIFBVCZHBKD-CBSRULBXSA-N |
| XLogP | 4.44 |
| TPSA | 170.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.19 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|