C26H27NO10 — CID 101019320
[(2R,3R,4R)-4,5-diacetyloxy-2-[(9H-fluoren-9-ylmethoxycarbonylamino)oxymethyl]oxolan-3-yl] acetate (PubChem CID 101019320) has the molecular formula C26H27NO10 and a molecular weight of 513.50 g/mol. Its IUPAC name is [(2R,3R,4R)-4,5-diacetyloxy-2-[(9H-fluoren-9-ylmethoxycarbonylamino)oxymethyl]oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4R)-4,5-diacetyloxy-2-[(9H-fluoren-9-ylmethoxycarbonylamino)oxymethyl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 101019320 |
| Molecular Formula | C26H27NO10 |
| Molecular Weight | 513.50 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | [(2R,3R,4R)-4,5-diacetyloxy-2-[(9H-fluoren-9-ylmethoxycarbonylamino)oxymethyl]oxolan-3-yl] acetate |
| SMILES | CC(=O)OC1O[C@H](CONC(=O)OCC2c3ccccc3-c3ccccc32)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C26H27NO10/c1-14(28)34-23-22(37-25(36-16(3)30)24(23)35-15(2)29)13-33-27-26(31)32-12-21-19-10-6-4-8-17(19)18-9-5-7-11-20(18)21/h4-11,21-25H,12-13H2,1-3H3,(H,27,31)/t22-,23-,24-,25?/m1/s1 |
| InChIKey | CDGPYEYERVBRHF-AWYPOSSQSA-N |
| XLogP | 2.61 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.50 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|