C30H35NO9 — CID 118606163
methyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(1S,6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propanoate (PubChem CID 118606163) has the molecular formula C30H35NO9 and a molecular weight of 553.61 g/mol. Its IUPAC name is methyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(1S,6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propanoate.
| Compound Name | methyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(1S,6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propanoate |
|---|---|
| PubChem CID | 118606163 |
| Molecular Formula | C30H35NO9 |
| Molecular Weight | 553.61 g/mol |
| Exact Mass | 553.23 |
| IUPAC Name | methyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(1S,6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propanoate |
| SMILES | COC(=O)[C@H](CC1O[C@@H]2OC(C)(C)OC2[C@H]2OC(C)(C)O[C@@H]12)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C30H35NO9/c1-29(2)37-23-22(36-27-25(24(23)38-29)39-30(3,4)40-27)14-21(26(32)34-5)31-28(33)35-15-20-18-12-8-6-10-16(18)17-11-7-9-13-19(17)20/h6-13,20-25,27H,14-15H2,1-5H3,(H,31,33)/t21-,22?,23-,24-,25?,27+/m0/s1 |
| InChIKey | IIKZRYKXDRJQHY-KGXNTXEKSA-N |
| XLogP | 3.85 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.61 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |