C24H27NO7 — CID 59073402
9H-fluoren-9-ylmethyl N-[(3aS,5R,6aS)-5-[(1S)-1,2-dihydroxyethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]carbamate (PubChem CID 59073402) has the molecular formula C24H27NO7 and a molecular weight of 441.48 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(3aS,5R,6aS)-5-[(1S)-1,2-dihydroxyethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(3aS,5R,6aS)-5-[(1S)-1,2-dihydroxyethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]carbamate |
|---|---|
| PubChem CID | 59073402 |
| Molecular Formula | C24H27NO7 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(3aS,5R,6aS)-5-[(1S)-1,2-dihydroxyethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]carbamate |
| SMILES | CC1(C)O[C@@H]2O[C@@H]([C@@H](O)CO)C(NC(=O)OCC3c4ccccc4-c4ccccc43)[C@@H]2O1 |
| InChI | InChI=1S/C24H27NO7/c1-24(2)31-21-19(20(18(27)11-26)30-22(21)32-24)25-23(28)29-12-17-15-9-5-3-7-13(15)14-8-4-6-10-16(14)17/h3-10,17-22,26-27H,11-12H2,1-2H3,(H,25,28)/t18-,19?,20-,21-,22-/m0/s1 |
| InChIKey | KFWDIBWGGHOKSN-USSJPZKSSA-N |
| XLogP | 2.12 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |