C22H25NO7 — CID 67640853
9H-fluoren-9-ylmethyl N-[(2S,3S,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]carbamate (PubChem CID 67640853) has the molecular formula C22H25NO7 and a molecular weight of 415.44 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2S,3S,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2S,3S,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]carbamate |
|---|---|
| PubChem CID | 67640853 |
| Molecular Formula | C22H25NO7 |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2S,3S,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]carbamate |
| SMILES | CO[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C22H25NO7/c1-28-21-18(20(26)19(25)17(10-24)30-21)23-22(27)29-11-16-14-8-4-2-6-12(14)13-7-3-5-9-15(13)16/h2-9,16-21,24-26H,10-11H2,1H3,(H,23,27)/t17-,18+,19-,20-,21+/m1/s1 |
| InChIKey | SLUDSZQKNXVHCL-XNTOXWQXSA-N |
| XLogP | 0.98 |
| TPSA | 117.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |