C27H33N3O9S — CID 15386175
9H-fluoren-9-ylmethyl N-[(2R)-3-(acetamidomethylsulfanyl)-1-oxo-1-[[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]propan-2-yl]carbamate (PubChem CID 15386175) has the molecular formula C27H33N3O9S and a molecular weight of 575.64 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2R)-3-(acetamidomethylsulfanyl)-1-oxo-1-[[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]propan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2R)-3-(acetamidomethylsulfanyl)-1-oxo-1-[[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 15386175 |
| Molecular Formula | C27H33N3O9S |
| Molecular Weight | 575.64 g/mol |
| Exact Mass | 575.19 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2R)-3-(acetamidomethylsulfanyl)-1-oxo-1-[[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]propan-2-yl]carbamate |
| SMILES | CC(=O)NCSC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C27H33N3O9S/c1-14(32)28-13-40-12-20(25(35)30-22-24(34)23(33)21(10-31)39-26(22)36)29-27(37)38-11-19-17-8-4-2-6-15(17)16-7-3-5-9-18(16)19/h2-9,19-24,26,31,33-34,36H,10-13H2,1H3,(H,28,32)(H,29,37)(H,30,35)/t20-,21+,22+,23+,24+,26?/m0/s1 |
| InChIKey | RYNDGGQDIOKTQG-MVWXVPEESA-N |
| XLogP | -0.36 |
| TPSA | 186.68 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.64 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|