C23H31NO10 — CID 158371618
ethyl (2S,3R)-3-[(3aS,4R,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-3-acetyloxy-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 158371618) has the molecular formula C23H31NO10 and a molecular weight of 481.50 g/mol. Its IUPAC name is ethyl (2S,3R)-3-[(3aS,4R,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-3-acetyloxy-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | ethyl (2S,3R)-3-[(3aS,4R,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-3-acetyloxy-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 158371618 |
| Molecular Formula | C23H31NO10 |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | ethyl (2S,3R)-3-[(3aS,4R,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-3-acetyloxy-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | CCOC(=O)[C@@H](NC(=O)OCc1ccccc1)[C@@H](OC(C)=O)[C@H]1O[C@@H](OC)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C23H31NO10/c1-6-29-20(26)15(24-22(27)30-12-14-10-8-7-9-11-14)16(31-13(2)25)17-18-19(21(28-5)32-17)34-23(3,4)33-18/h7-11,15-19,21H,6,12H2,1-5H3,(H,24,27)/t15-,16+,17+,18-,19-,21+/m0/s1 |
| InChIKey | GURICOMWXUXWAX-UCWVGABGSA-N |
| XLogP | 1.67 |
| TPSA | 127.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|