C17H24O6 — CID 10892681
(2R)-2-[(3aS,4S,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-phenylmethoxyethanol (PubChem CID 10892681) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is (2R)-2-[(3aS,4S,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-phenylmethoxyethanol.
| Compound Name | (2R)-2-[(3aS,4S,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-phenylmethoxyethanol |
|---|---|
| PubChem CID | 10892681 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | (2R)-2-[(3aS,4S,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-phenylmethoxyethanol |
| SMILES | CO[C@H]1O[C@H]([C@@H](CO)OCc2ccccc2)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C17H24O6/c1-17(2)22-14-13(21-16(19-3)15(14)23-17)12(9-18)20-10-11-7-5-4-6-8-11/h4-8,12-16,18H,9-10H2,1-3H3/t12-,13-,14+,15+,16+/m1/s1 |
| InChIKey | LHKGYTIRXFUCJZ-OWYFMNJBSA-N |
| XLogP | 1.46 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |