C26H36O6Si — CID 101117871
(1R)-1-[(3aS,4S,6R,7R,7aS)-4-methoxy-2,2-dimethyl-7-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]-2-[dimethyl(phenyl)silyl]ethanol (PubChem CID 101117871) has the molecular formula C26H36O6Si and a molecular weight of 472.65 g/mol. Its IUPAC name is (1R)-1-[(3aS,4S,6R,7R,7aS)-4-methoxy-2,2-dimethyl-7-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]-2-[dimethyl(phenyl)silyl]ethanol.
| Compound Name | (1R)-1-[(3aS,4S,6R,7R,7aS)-4-methoxy-2,2-dimethyl-7-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]-2-[dimethyl(phenyl)silyl]ethanol |
|---|---|
| PubChem CID | 101117871 |
| Molecular Formula | C26H36O6Si |
| Molecular Weight | 472.65 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | (1R)-1-[(3aS,4S,6R,7R,7aS)-4-methoxy-2,2-dimethyl-7-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]-2-[dimethyl(phenyl)silyl]ethanol |
| SMILES | CO[C@H]1O[C@H]([C@@H](O)C[Si](C)(C)c2ccccc2)[C@@H](OCc2ccccc2)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C26H36O6Si/c1-26(2)31-23-22(29-16-18-12-8-6-9-13-18)21(30-25(28-3)24(23)32-26)20(27)17-33(4,5)19-14-10-7-11-15-19/h6-15,20-25,27H,16-17H2,1-5H3/t20-,21+,22+,23-,24-,25-/m0/s1 |
| InChIKey | GLLUHGHYHGPGJZ-AIOSZGMZSA-N |
| XLogP | 3.44 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.65 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|