C16H18N4O3 — CID 91324370
[2-(5-benzyltetrazol-2-yl)-3,6-dihydro-2H-pyran-6-yl]methyl acetate (PubChem CID 91324370) has the molecular formula C16H18N4O3 and a molecular weight of 314.35 g/mol. Its IUPAC name is [2-(5-benzyltetrazol-2-yl)-3,6-dihydro-2H-pyran-6-yl]methyl acetate.
| Compound Name | [2-(5-benzyltetrazol-2-yl)-3,6-dihydro-2H-pyran-6-yl]methyl acetate |
|---|---|
| PubChem CID | 91324370 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | [2-(5-benzyltetrazol-2-yl)-3,6-dihydro-2H-pyran-6-yl]methyl acetate |
| SMILES | CC(=O)OCC1C=CCC(n2nnc(Cc3ccccc3)n2)O1 |
| InChI | InChI=1S/C16H18N4O3/c1-12(21)22-11-14-8-5-9-16(23-14)20-18-15(17-19-20)10-13-6-3-2-4-7-13/h2-8,14,16H,9-11H2,1H3 |
| InChIKey | NVRYOGOJXXBTHI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|