C22H25BrN4O9 — CID 44816343
[3,4,5-triacetyloxy-6-[5-[(4-bromophenyl)methyl]tetrazol-2-yl]oxan-2-yl]methyl acetate (PubChem CID 44816343) has the molecular formula C22H25BrN4O9 and a molecular weight of 569.37 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-[5-[(4-bromophenyl)methyl]tetrazol-2-yl]oxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-[5-[(4-bromophenyl)methyl]tetrazol-2-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 44816343 |
| Molecular Formula | C22H25BrN4O9 |
| Molecular Weight | 569.37 g/mol |
| Exact Mass | 568.08 |
| IUPAC Name | [3,4,5-triacetyloxy-6-[5-[(4-bromophenyl)methyl]tetrazol-2-yl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(n2nnc(Cc3ccc(Br)cc3)n2)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C22H25BrN4O9/c1-11(28)32-10-17-19(33-12(2)29)20(34-13(3)30)21(35-14(4)31)22(36-17)27-25-18(24-26-27)9-15-5-7-16(23)8-6-15/h5-8,17,19-22H,9-10H2,1-4H3 |
| InChIKey | BIPDCAHXAIHZEU-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 158.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.37 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|