C24H24BrFN2O13S — CID 10604568
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[3-(4-bromophenyl)sulfonyl-5-fluoro-2,6-dioxopyrimidin-1-yl]oxan-2-yl]methyl acetate (PubChem CID 10604568) has the molecular formula C24H24BrFN2O13S and a molecular weight of 679.43 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[3-(4-bromophenyl)sulfonyl-5-fluoro-2,6-dioxopyrimidin-1-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[3-(4-bromophenyl)sulfonyl-5-fluoro-2,6-dioxopyrimidin-1-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10604568 |
| Molecular Formula | C24H24BrFN2O13S |
| Molecular Weight | 679.43 g/mol |
| Exact Mass | 678.02 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[3-(4-bromophenyl)sulfonyl-5-fluoro-2,6-dioxopyrimidin-1-yl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2c(=O)c(F)cn(S(=O)(=O)c3ccc(Br)cc3)c2=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H24BrFN2O13S/c1-11(29)37-10-18-19(38-12(2)30)20(39-13(3)31)21(40-14(4)32)23(41-18)28-22(33)17(26)9-27(24(28)34)42(35,36)16-7-5-15(25)6-8-16/h5-9,18-21,23H,10H2,1-4H3/t18-,19-,20+,21-,23-/m1/s1 |
| InChIKey | UPKJPWSCZRFPOK-ZFVIQDPVSA-N |
| XLogP | 0.40 |
| TPSA | 192.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.43 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|