C23H24FN3O12S — CID 10531387
[(3R,4S,5R,6R)-6-[3-(4-acetamidophenyl)sulfonyl-5-fluoro-2,6-dioxopyrimidin-1-yl]-4,5-diacetyloxyoxan-3-yl] acetate (PubChem CID 10531387) has the molecular formula C23H24FN3O12S and a molecular weight of 585.52 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-6-[3-(4-acetamidophenyl)sulfonyl-5-fluoro-2,6-dioxopyrimidin-1-yl]-4,5-diacetyloxyoxan-3-yl] acetate.
| Compound Name | [(3R,4S,5R,6R)-6-[3-(4-acetamidophenyl)sulfonyl-5-fluoro-2,6-dioxopyrimidin-1-yl]-4,5-diacetyloxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 10531387 |
| Molecular Formula | C23H24FN3O12S |
| Molecular Weight | 585.52 g/mol |
| Exact Mass | 585.11 |
| IUPAC Name | [(3R,4S,5R,6R)-6-[3-(4-acetamidophenyl)sulfonyl-5-fluoro-2,6-dioxopyrimidin-1-yl]-4,5-diacetyloxyoxan-3-yl] acetate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)n2cc(F)c(=O)n([C@@H]3OC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]3OC(C)=O)c2=O)cc1 |
| InChI | InChI=1S/C23H24FN3O12S/c1-11(28)25-15-5-7-16(8-6-15)40(34,35)26-9-17(24)21(32)27(23(26)33)22-20(39-14(4)31)19(38-13(3)30)18(10-36-22)37-12(2)29/h5-9,18-20,22H,10H2,1-4H3,(H,25,28)/t18-,19+,20-,22-/m1/s1 |
| InChIKey | QXHASEGXJXTFSD-XAPVIXHLSA-N |
| XLogP | -0.33 |
| TPSA | 195.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.52 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|