C31H33N3O10S — CID 14540128
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[5-[(4-methoxyphenyl)methyl]-3-phenyl-6-sulfanylidene-1,2,4-triazin-1-yl]oxan-2-yl]methyl acetate (PubChem CID 14540128) has the molecular formula C31H33N3O10S and a molecular weight of 639.68 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[5-[(4-methoxyphenyl)methyl]-3-phenyl-6-sulfanylidene-1,2,4-triazin-1-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[5-[(4-methoxyphenyl)methyl]-3-phenyl-6-sulfanylidene-1,2,4-triazin-1-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 14540128 |
| Molecular Formula | C31H33N3O10S |
| Molecular Weight | 639.68 g/mol |
| Exact Mass | 639.19 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[5-[(4-methoxyphenyl)methyl]-3-phenyl-6-sulfanylidene-1,2,4-triazin-1-yl]oxan-2-yl]methyl acetate |
| SMILES | COc1ccc(Cc2nc(-c3ccccc3)nn([C@@H]3O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]3OC(C)=O)c2=S)cc1 |
| InChI | InChI=1S/C31H33N3O10S/c1-17(35)40-16-25-26(41-18(2)36)27(42-19(3)37)28(43-20(4)38)30(44-25)34-31(45)24(15-21-11-13-23(39-5)14-12-21)32-29(33-34)22-9-7-6-8-10-22/h6-14,25-28,30H,15-16H2,1-5H3/t25-,26-,27+,28-,30-/m1/s1 |
| InChIKey | JOMACKBPQRXCCV-OVFYEYCDSA-N |
| XLogP | 3.53 |
| TPSA | 154.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.68 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|