C30H33N4O10S+ — CID 135771927
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[(E)-(4-methoxyphenyl)methylideneamino]-5-phenyl-3-sulfanylidene-1H-1,2,4-triazol-4-ium-2-yl]oxan-2-yl]methyl acetate (PubChem CID 135771927) has the molecular formula C30H33N4O10S+ and a molecular weight of 641.68 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[(E)-(4-methoxyphenyl)methylideneamino]-5-phenyl-3-sulfanylidene-1H-1,2,4-triazol-4-ium-2-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[(E)-(4-methoxyphenyl)methylideneamino]-5-phenyl-3-sulfanylidene-1H-1,2,4-triazol-4-ium-2-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 135771927 |
| Molecular Formula | C30H33N4O10S+ |
| Molecular Weight | 641.68 g/mol |
| Exact Mass | 641.19 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[(E)-(4-methoxyphenyl)methylideneamino]-5-phenyl-3-sulfanylidene-1H-1,2,4-triazol-4-ium-2-yl]oxan-2-yl]methyl acetate |
| SMILES | COc1ccc(/C=N/[n+]2c(-c3ccccc3)[nH]n([C@@H]3O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]3OC(C)=O)c2=S)cc1 |
| InChI | InChI=1S/C30H32N4O10S/c1-17(35)40-16-24-25(41-18(2)36)26(42-19(3)37)27(43-20(4)38)29(44-24)34-30(45)33(28(32-34)22-9-7-6-8-10-22)31-15-21-11-13-23(39-5)14-12-21/h6-15,24-27,29H,16H2,1-5H3/p+1/b31-15+/t24-,25-,26+,27-,29-/m1/s1 |
| InChIKey | AYKYNQBGMXGLHK-APGXIULASA-O |
| XLogP | 2.65 |
| TPSA | 160.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.68 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|