C30H32N4O11S — CID 135857216
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-3-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl]oxan-2-yl]methyl acetate (PubChem CID 135857216) has the molecular formula C30H32N4O11S and a molecular weight of 656.67 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-3-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-3-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 135857216 |
| Molecular Formula | C30H32N4O11S |
| Molecular Weight | 656.67 g/mol |
| Exact Mass | 656.18 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-3-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl]oxan-2-yl]methyl acetate |
| SMILES | COc1cc(/C=N/n2c(-c3ccccc3)nn([C@@H]3O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]3OC(C)=O)c2=S)ccc1O |
| InChI | InChI=1S/C30H32N4O11S/c1-16(35)41-15-24-25(42-17(2)36)26(43-18(3)37)27(44-19(4)38)29(45-24)34-30(46)33(28(32-34)21-9-7-6-8-10-21)31-14-20-11-12-22(39)23(13-20)40-5/h6-14,24-27,29,39H,15H2,1-5H3/b31-14+/t24-,25-,26+,27-,29-/m1/s1 |
| InChIKey | BJDWGKPBKQUAPT-ZLWVMSRWSA-N |
| XLogP | 2.93 |
| TPSA | 179.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.67 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|