C26H30N4O11S — CID 11973690
[(3R,4R,6R)-3,4,5-triacetyloxy-6-[4-amino-6-[(E)-2-(4-methoxyphenyl)ethenyl]-5-oxo-3-sulfanylidene-1,2,4-triazin-2-yl]oxan-2-yl]methyl acetate (PubChem CID 11973690) has the molecular formula C26H30N4O11S and a molecular weight of 606.61 g/mol. Its IUPAC name is [(3R,4R,6R)-3,4,5-triacetyloxy-6-[4-amino-6-[(E)-2-(4-methoxyphenyl)ethenyl]-5-oxo-3-sulfanylidene-1,2,4-triazin-2-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(3R,4R,6R)-3,4,5-triacetyloxy-6-[4-amino-6-[(E)-2-(4-methoxyphenyl)ethenyl]-5-oxo-3-sulfanylidene-1,2,4-triazin-2-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11973690 |
| Molecular Formula | C26H30N4O11S |
| Molecular Weight | 606.61 g/mol |
| Exact Mass | 606.16 |
| IUPAC Name | [(3R,4R,6R)-3,4,5-triacetyloxy-6-[4-amino-6-[(E)-2-(4-methoxyphenyl)ethenyl]-5-oxo-3-sulfanylidene-1,2,4-triazin-2-yl]oxan-2-yl]methyl acetate |
| SMILES | COc1ccc(/C=C/c2nn([C@@H]3OC(COC(C)=O)[C@@H](OC(C)=O)[C@@H](OC(C)=O)C3OC(C)=O)c(=S)n(N)c2=O)cc1 |
| InChI | InChI=1S/C26H30N4O11S/c1-13(31)37-12-20-21(38-14(2)32)22(39-15(3)33)23(40-16(4)34)25(41-20)30-26(42)29(27)24(35)19(28-30)11-8-17-6-9-18(36-5)10-7-17/h6-11,20-23,25H,12,27H2,1-5H3/b11-8+/t20?,21-,22-,23?,25-/m1/s1 |
| InChIKey | KMNYGGBQUOHDOV-IKNQDWFXSA-N |
| XLogP | 0.92 |
| TPSA | 189.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.61 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|