C29H36O11S — CID 142849681
ethane;[3,4,5-triacetyloxy-6-[2-[(E)-2-(4-methoxyphenyl)ethenyl]thiophen-3-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 142849681) has the molecular formula C29H36O11S and a molecular weight of 592.66 g/mol. Its IUPAC name is ethane;[3,4,5-triacetyloxy-6-[2-[(E)-2-(4-methoxyphenyl)ethenyl]thiophen-3-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | ethane;[3,4,5-triacetyloxy-6-[2-[(E)-2-(4-methoxyphenyl)ethenyl]thiophen-3-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 142849681 |
| Molecular Formula | C29H36O11S |
| Molecular Weight | 592.66 g/mol |
| Exact Mass | 592.20 |
| IUPAC Name | ethane;[3,4,5-triacetyloxy-6-[2-[(E)-2-(4-methoxyphenyl)ethenyl]thiophen-3-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC.COc1ccc(/C=C/c2sccc2OC2OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C2OC(C)=O)cc1 |
| InChI | InChI=1S/C27H30O11S.C2H6/c1-15(28)33-14-22-24(34-16(2)29)25(35-17(3)30)26(36-18(4)31)27(38-22)37-21-12-13-39-23(21)11-8-19-6-9-20(32-5)10-7-19;1-2/h6-13,22,24-27H,14H2,1-5H3;1-2H3/b11-8+; |
| InChIKey | YZOIDUNJQNKDCB-YGCVIUNWSA-N |
| XLogP | 4.42 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.66 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|