C26H28O12S — CID 21045300
[3,4,5-triacetyloxy-6-[2-(4-methoxybenzoyl)thiophen-3-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 21045300) has the molecular formula C26H28O12S and a molecular weight of 564.57 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-[2-(4-methoxybenzoyl)thiophen-3-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-[2-(4-methoxybenzoyl)thiophen-3-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 21045300 |
| Molecular Formula | C26H28O12S |
| Molecular Weight | 564.57 g/mol |
| Exact Mass | 564.13 |
| IUPAC Name | [3,4,5-triacetyloxy-6-[2-(4-methoxybenzoyl)thiophen-3-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | COc1ccc(C(=O)c2sccc2OC2OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C2OC(C)=O)cc1 |
| InChI | InChI=1S/C26H28O12S/c1-13(27)33-12-20-22(34-14(2)28)23(35-15(3)29)24(36-16(4)30)26(38-20)37-19-10-11-39-25(19)21(31)17-6-8-18(32-5)9-7-17/h6-11,20,22-24,26H,12H2,1-5H3 |
| InChIKey | NHELDRUPAZJFBS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.57 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|